C7H3F5Y-2 — CID 59920259
carbanide;1,2,3,4,5-pentafluorobenzene-6-ide;yttrium (PubChem CID 59920259) has the molecular formula C7H3F5Y-2 and a molecular weight of 271.00 g/mol. Its IUPAC name is carbanide;1,2,3,4,5-pentafluorobenzene-6-ide;yttrium.
| Compound Name | carbanide;1,2,3,4,5-pentafluorobenzene-6-ide;yttrium |
|---|---|
| PubChem CID | 59920259 |
| Molecular Formula | C7H3F5Y-2 |
| Molecular Weight | 271.00 g/mol |
| Exact Mass | 270.92 |
| IUPAC Name | carbanide;1,2,3,4,5-pentafluorobenzene-6-ide;yttrium |
| SMILES | Fc1[c-]c(F)c(F)c(F)c1F.[CH3-].[Y] |
| InChI | InChI=1S/C6F5.CH3.Y/c7-2-1-3(8)5(10)6(11)4(2)9;;/h;1H3;/q2*-1; |
| InChIKey | OLVYQIVVIBPFGT-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.00 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|