C12H18O8 — CID 59920283
(12Z)-1,4,7,10-tetraoxacyclotetradec-12-ene-5,6-dicarboxylic acid (PubChem CID 59920283) has the molecular formula C12H18O8 and a molecular weight of 290.27 g/mol. Its IUPAC name is (12Z)-1,4,7,10-tetraoxacyclotetradec-12-ene-5,6-dicarboxylic acid.
| Compound Name | (12Z)-1,4,7,10-tetraoxacyclotetradec-12-ene-5,6-dicarboxylic acid |
|---|---|
| PubChem CID | 59920283 |
| Molecular Formula | C12H18O8 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | (12Z)-1,4,7,10-tetraoxacyclotetradec-12-ene-5,6-dicarboxylic acid |
| SMILES | O=C(O)C1OCCOC/C=C\COCCOC1C(=O)O |
| InChI | InChI=1S/C12H18O8/c13-11(14)9-10(12(15)16)20-8-6-18-4-2-1-3-17-5-7-19-9/h1-2,9-10H,3-8H2,(H,13,14)(H,15,16)/b2-1- |
| InChIKey | QABPCZHLQLVAHC-UPHRSURJSA-N |
| XLogP | -0.47 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|