About (15Z)-1,4,10,13-tetraoxa-7-azoniacycloheptadec-15-ene
(15Z)-1,4,10,13-tetraoxa-7-azoniacycloheptadec-15-ene (PubChem CID 59920285) has the molecular formula C12H24NO4+
and a molecular weight of 246.33 g/mol. Its IUPAC name is (15Z)-1,4,10,13-tetraoxa-7-azoniacycloheptadec-15-ene.
Molecular Properties
| Compound Name | (15Z)-1,4,10,13-tetraoxa-7-azoniacycloheptadec-15-ene |
| PubChem CID | 59920285 |
| Molecular Formula | C12H24NO4+ |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | (15Z)-1,4,10,13-tetraoxa-7-azoniacycloheptadec-15-ene |
| SMILES | C1=C\COCCOCC[NH2+]CCOCCOC/1 |
| InChI | InChI=1S/C12H23NO4/c1-2-6-15-10-12-17-8-4-13-3-7-16-11-9-14-5-1/h1-2,13H,3-12H2/p+1/b2-1- |
| InChIKey | MXBOFNAJEHTBGJ-UPHRSURJSA-O |
| XLogP | -0.81 |
| TPSA | 53.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (15Z)-1,4,10,13-tetraoxa-7-azoniacycloheptadec-15-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (15Z)-1,4,10,13-tetraoxa-7-azoniacycloheptadec-15-ene?
The IUPAC name of (15Z)-1,4,10,13-tetraoxa-7-azoniacycloheptadec-15-ene (CID 59920285) is (15Z)-1,4,10,13-tetraoxa-7-azoniacycloheptadec-15-ene.
What is the SMILES notation for (15Z)-1,4,10,13-tetraoxa-7-azoniacycloheptadec-15-ene?
The canonical SMILES for (15Z)-1,4,10,13-tetraoxa-7-azoniacycloheptadec-15-ene is C1=C\COCCOCC[NH2+]CCOCCOC/1.
What is the InChIKey of (15Z)-1,4,10,13-tetraoxa-7-azoniacycloheptadec-15-ene?
The InChIKey is MXBOFNAJEHTBGJ-UPHRSURJSA-O. The full InChI is InChI=1S/C12H23NO4/c1-2-6-15-10-12-17-8-4-13-3-7-16-11-9-14-5-1/h1-2,13H,3-12H2/p+1/b2-1-.
What are the key properties of (15Z)-1,4,10,13-tetraoxa-7-azoniacycloheptadec-15-ene?
(15Z)-1,4,10,13-tetraoxa-7-azoniacycloheptadec-15-ene has a molecular weight of 246.33 g/mol, XLogP of -0.81, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (15Z)-1,4,10,13-tetraoxa-7-azoniacycloheptadec-15-ene is sourced from PubChem (CID 59920285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).