C23H17NO2S — CID 59920461
methyl 2-cyano-3-[5-(2,2-diphenylethenyl)thiophen-2-yl]prop-2-enoate (PubChem CID 59920461) has the molecular formula C23H17NO2S and a molecular weight of 371.46 g/mol. Its IUPAC name is methyl 2-cyano-3-[5-(2,2-diphenylethenyl)thiophen-2-yl]prop-2-enoate.
| Compound Name | methyl 2-cyano-3-[5-(2,2-diphenylethenyl)thiophen-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 59920461 |
| Molecular Formula | C23H17NO2S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | methyl 2-cyano-3-[5-(2,2-diphenylethenyl)thiophen-2-yl]prop-2-enoate |
| SMILES | COC(=O)C(C#N)=Cc1ccc(C=C(c2ccccc2)c2ccccc2)s1 |
| InChI | InChI=1S/C23H17NO2S/c1-26-23(25)19(16-24)14-20-12-13-21(27-20)15-22(17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-15H,1H3 |
| InChIKey | RWKGTEDEJZPPLS-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|