About (4S)-2-ethyl-4,5-dimethyloxane
(4S)-2-ethyl-4,5-dimethyloxane (PubChem CID 59920802) has the molecular formula C9H18O
and a molecular weight of 142.24 g/mol. Its IUPAC name is (4S)-2-ethyl-4,5-dimethyloxane.
Molecular Properties
| Compound Name | (4S)-2-ethyl-4,5-dimethyloxane |
| PubChem CID | 59920802 |
| Molecular Formula | C9H18O |
| Molecular Weight | 142.24 g/mol |
| Exact Mass | 142.14 |
| IUPAC Name | (4S)-2-ethyl-4,5-dimethyloxane |
| SMILES | CCC1C[C@H](C)C(C)CO1 |
| InChI | InChI=1S/C9H18O/c1-4-9-5-7(2)8(3)6-10-9/h7-9H,4-6H2,1-3H3/t7-,8?,9?/m0/s1 |
| InChIKey | WAQSITIFUZZTPQ-UEJVZZJDSA-N |
| XLogP | 2.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.24 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4S)-2-ethyl-4,5-dimethyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-2-ethyl-4,5-dimethyloxane?
The IUPAC name of (4S)-2-ethyl-4,5-dimethyloxane (CID 59920802) is (4S)-2-ethyl-4,5-dimethyloxane.
What is the SMILES notation for (4S)-2-ethyl-4,5-dimethyloxane?
The canonical SMILES for (4S)-2-ethyl-4,5-dimethyloxane is CCC1C[C@H](C)C(C)CO1.
What is the InChIKey of (4S)-2-ethyl-4,5-dimethyloxane?
The InChIKey is WAQSITIFUZZTPQ-UEJVZZJDSA-N. The full InChI is InChI=1S/C9H18O/c1-4-9-5-7(2)8(3)6-10-9/h7-9H,4-6H2,1-3H3/t7-,8?,9?/m0/s1.
What are the key properties of (4S)-2-ethyl-4,5-dimethyloxane?
(4S)-2-ethyl-4,5-dimethyloxane has a molecular weight of 142.24 g/mol, XLogP of 2.46, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-2-ethyl-4,5-dimethyloxane is sourced from PubChem (CID 59920802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).