C26H31FN4O — CID 59920987
2-[4-[2-[2-(4-fluorophenyl)-1H-indol-3-yl]ethyl]piperazin-1-yl]-1-pyrrolidin-1-ylethanone (PubChem CID 59920987) has the molecular formula C26H31FN4O and a molecular weight of 434.56 g/mol. Its IUPAC name is 2-[4-[2-[2-(4-fluorophenyl)-1H-indol-3-yl]ethyl]piperazin-1-yl]-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-[4-[2-[2-(4-fluorophenyl)-1H-indol-3-yl]ethyl]piperazin-1-yl]-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 59920987 |
| Molecular Formula | C26H31FN4O |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | 2-[4-[2-[2-(4-fluorophenyl)-1H-indol-3-yl]ethyl]piperazin-1-yl]-1-pyrrolidin-1-ylethanone |
| SMILES | O=C(CN1CCN(CCc2c(-c3ccc(F)cc3)[nH]c3ccccc23)CC1)N1CCCC1 |
| InChI | InChI=1S/C26H31FN4O/c27-21-9-7-20(8-10-21)26-23(22-5-1-2-6-24(22)28-26)11-14-29-15-17-30(18-16-29)19-25(32)31-12-3-4-13-31/h1-2,5-10,28H,3-4,11-19H2 |
| InChIKey | KDMDHVFRAULGTA-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 42.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |