About 4-propan-2-yl-1-(2,2,2-trifluoroethylsulfonyl)piperidine
4-propan-2-yl-1-(2,2,2-trifluoroethylsulfonyl)piperidine (PubChem CID 59921674) has the molecular formula C10H18F3NO2S
and a molecular weight of 273.32 g/mol. Its IUPAC name is 4-propan-2-yl-1-(2,2,2-trifluoroethylsulfonyl)piperidine.
Molecular Properties
| Compound Name | 4-propan-2-yl-1-(2,2,2-trifluoroethylsulfonyl)piperidine |
| PubChem CID | 59921674 |
| Molecular Formula | C10H18F3NO2S |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 4-propan-2-yl-1-(2,2,2-trifluoroethylsulfonyl)piperidine |
| SMILES | CC(C)C1CCN(S(=O)(=O)CC(F)(F)F)CC1 |
| InChI | InChI=1S/C10H18F3NO2S/c1-8(2)9-3-5-14(6-4-9)17(15,16)7-10(11,12)13/h8-9H,3-7H2,1-2H3 |
| InChIKey | RTWNADRGDYRHIW-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-propan-2-yl-1-(2,2,2-trifluoroethylsulfonyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-yl-1-(2,2,2-trifluoroethylsulfonyl)piperidine?
The IUPAC name of 4-propan-2-yl-1-(2,2,2-trifluoroethylsulfonyl)piperidine (CID 59921674) is 4-propan-2-yl-1-(2,2,2-trifluoroethylsulfonyl)piperidine.
What is the SMILES notation for 4-propan-2-yl-1-(2,2,2-trifluoroethylsulfonyl)piperidine?
The canonical SMILES for 4-propan-2-yl-1-(2,2,2-trifluoroethylsulfonyl)piperidine is CC(C)C1CCN(S(=O)(=O)CC(F)(F)F)CC1.
What is the InChIKey of 4-propan-2-yl-1-(2,2,2-trifluoroethylsulfonyl)piperidine?
The InChIKey is RTWNADRGDYRHIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F3NO2S/c1-8(2)9-3-5-14(6-4-9)17(15,16)7-10(11,12)13/h8-9H,3-7H2,1-2H3.
What are the key properties of 4-propan-2-yl-1-(2,2,2-trifluoroethylsulfonyl)piperidine?
4-propan-2-yl-1-(2,2,2-trifluoroethylsulfonyl)piperidine has a molecular weight of 273.32 g/mol, XLogP of 2.25, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-yl-1-(2,2,2-trifluoroethylsulfonyl)piperidine is sourced from PubChem (CID 59921674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).