About methyl 2-[5-(3-methyl-1,2,4-oxadiazol-5-yl)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]acetate
methyl 2-[5-(3-methyl-1,2,4-oxadiazol-5-yl)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]acetate (PubChem CID 59921690) has the molecular formula C18H22N2O6
and a molecular weight of 362.38 g/mol. Its IUPAC name is methyl 2-[5-(3-methyl-1,2,4-oxadiazol-5-yl)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]acetate.
Molecular Properties
| Compound Name | methyl 2-[5-(3-methyl-1,2,4-oxadiazol-5-yl)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]acetate |
| PubChem CID | 59921690 |
| Molecular Formula | C18H22N2O6 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | methyl 2-[5-(3-methyl-1,2,4-oxadiazol-5-yl)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]acetate |
| SMILES | COC(=O)Cc1cc(-c2nc(C)no2)ccc1OCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H22N2O6/c1-11-19-17(26-20-11)12-6-7-14(13(8-12)9-15(21)23-5)24-10-16(22)25-18(2,3)4/h6-8H,9-10H2,1-5H3 |
| InChIKey | ZQNDXZIWCUGSOP-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 100.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze methyl 2-[5-(3-methyl-1,2,4-oxadiazol-5-yl)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[5-(3-methyl-1,2,4-oxadiazol-5-yl)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]acetate?
The IUPAC name of methyl 2-[5-(3-methyl-1,2,4-oxadiazol-5-yl)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]acetate (CID 59921690) is methyl 2-[5-(3-methyl-1,2,4-oxadiazol-5-yl)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]acetate.
What is the SMILES notation for methyl 2-[5-(3-methyl-1,2,4-oxadiazol-5-yl)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]acetate?
The canonical SMILES for methyl 2-[5-(3-methyl-1,2,4-oxadiazol-5-yl)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]acetate is COC(=O)Cc1cc(-c2nc(C)no2)ccc1OCC(=O)OC(C)(C)C.
What is the InChIKey of methyl 2-[5-(3-methyl-1,2,4-oxadiazol-5-yl)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]acetate?
The InChIKey is ZQNDXZIWCUGSOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2O6/c1-11-19-17(26-20-11)12-6-7-14(13(8-12)9-15(21)23-5)24-10-16(22)25-18(2,3)4/h6-8H,9-10H2,1-5H3.
What are the key properties of methyl 2-[5-(3-methyl-1,2,4-oxadiazol-5-yl)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]acetate?
methyl 2-[5-(3-methyl-1,2,4-oxadiazol-5-yl)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]acetate has a molecular weight of 362.38 g/mol, XLogP of 2.48, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[5-(3-methyl-1,2,4-oxadiazol-5-yl)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]acetate is sourced from PubChem (CID 59921690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).