About 5-[(Z)-2-(5-tert-butyl-1,3-oxazol-2-yl)ethenyl]-N-pyridin-2-yl-1,3-thiazol-2-amine
5-[(Z)-2-(5-tert-butyl-1,3-oxazol-2-yl)ethenyl]-N-pyridin-2-yl-1,3-thiazol-2-amine (PubChem CID 59921760) has the molecular formula C17H18N4OS
and a molecular weight of 326.43 g/mol. Its IUPAC name is 5-[(Z)-2-(5-tert-butyl-1,3-oxazol-2-yl)ethenyl]-N-pyridin-2-yl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 5-[(Z)-2-(5-tert-butyl-1,3-oxazol-2-yl)ethenyl]-N-pyridin-2-yl-1,3-thiazol-2-amine |
| PubChem CID | 59921760 |
| Molecular Formula | C17H18N4OS |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 5-[(Z)-2-(5-tert-butyl-1,3-oxazol-2-yl)ethenyl]-N-pyridin-2-yl-1,3-thiazol-2-amine |
| SMILES | CC(C)(C)c1cnc(/C=C\c2cnc(Nc3ccccn3)s2)o1 |
| InChI | InChI=1S/C17H18N4OS/c1-17(2,3)13-11-19-15(22-13)8-7-12-10-20-16(23-12)21-14-6-4-5-9-18-14/h4-11H,1-3H3,(H,18,20,21)/b8-7- |
| InChIKey | IHTBJFMJRPPWJF-FPLPWBNLSA-N |
| XLogP | 4.74 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[(Z)-2-(5-tert-butyl-1,3-oxazol-2-yl)ethenyl]-N-pyridin-2-yl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(Z)-2-(5-tert-butyl-1,3-oxazol-2-yl)ethenyl]-N-pyridin-2-yl-1,3-thiazol-2-amine?
The IUPAC name of 5-[(Z)-2-(5-tert-butyl-1,3-oxazol-2-yl)ethenyl]-N-pyridin-2-yl-1,3-thiazol-2-amine (CID 59921760) is 5-[(Z)-2-(5-tert-butyl-1,3-oxazol-2-yl)ethenyl]-N-pyridin-2-yl-1,3-thiazol-2-amine.
What is the SMILES notation for 5-[(Z)-2-(5-tert-butyl-1,3-oxazol-2-yl)ethenyl]-N-pyridin-2-yl-1,3-thiazol-2-amine?
The canonical SMILES for 5-[(Z)-2-(5-tert-butyl-1,3-oxazol-2-yl)ethenyl]-N-pyridin-2-yl-1,3-thiazol-2-amine is CC(C)(C)c1cnc(/C=C\c2cnc(Nc3ccccn3)s2)o1.
What is the InChIKey of 5-[(Z)-2-(5-tert-butyl-1,3-oxazol-2-yl)ethenyl]-N-pyridin-2-yl-1,3-thiazol-2-amine?
The InChIKey is IHTBJFMJRPPWJF-FPLPWBNLSA-N. The full InChI is InChI=1S/C17H18N4OS/c1-17(2,3)13-11-19-15(22-13)8-7-12-10-20-16(23-12)21-14-6-4-5-9-18-14/h4-11H,1-3H3,(H,18,20,21)/b8-7-.
What are the key properties of 5-[(Z)-2-(5-tert-butyl-1,3-oxazol-2-yl)ethenyl]-N-pyridin-2-yl-1,3-thiazol-2-amine?
5-[(Z)-2-(5-tert-butyl-1,3-oxazol-2-yl)ethenyl]-N-pyridin-2-yl-1,3-thiazol-2-amine has a molecular weight of 326.43 g/mol, XLogP of 4.74, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(Z)-2-(5-tert-butyl-1,3-oxazol-2-yl)ethenyl]-N-pyridin-2-yl-1,3-thiazol-2-amine is sourced from PubChem (CID 59921760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).