C9H16F4N2O — CID 59921966
1-(2-ethoxy-1,1,2,2-tetrafluoroethyl)-4-methylpiperazine (PubChem CID 59921966) has the molecular formula C9H16F4N2O and a molecular weight of 244.23 g/mol. Its IUPAC name is 1-(2-ethoxy-1,1,2,2-tetrafluoroethyl)-4-methylpiperazine.
| Compound Name | 1-(2-ethoxy-1,1,2,2-tetrafluoroethyl)-4-methylpiperazine |
|---|---|
| PubChem CID | 59921966 |
| Molecular Formula | C9H16F4N2O |
| Molecular Weight | 244.23 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 1-(2-ethoxy-1,1,2,2-tetrafluoroethyl)-4-methylpiperazine |
| SMILES | CCOC(F)(F)C(F)(F)N1CCN(C)CC1 |
| InChI | InChI=1S/C9H16F4N2O/c1-3-16-9(12,13)8(10,11)15-6-4-14(2)5-7-15/h3-7H2,1-2H3 |
| InChIKey | GQGRINPDDGNGJO-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.23 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|