C12H11O2- — CID 59922452
2-buta-1,3-dienyl-4-but-2-enylidene-3-oxocyclobuten-1-olate (PubChem CID 59922452) has the molecular formula C12H11O2- and a molecular weight of 187.22 g/mol. Its IUPAC name is 2-buta-1,3-dienyl-4-but-2-enylidene-3-oxocyclobuten-1-olate.
| Compound Name | 2-buta-1,3-dienyl-4-but-2-enylidene-3-oxocyclobuten-1-olate |
|---|---|
| PubChem CID | 59922452 |
| Molecular Formula | C12H11O2- |
| Molecular Weight | 187.22 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | 2-buta-1,3-dienyl-4-but-2-enylidene-3-oxocyclobuten-1-olate |
| SMILES | C=CC=CC1=C([O-])C(=CC=CC)C1=O |
| InChI | InChI=1S/C12H12O2/c1-3-5-7-9-11(13)10(12(9)14)8-6-4-2/h3-8,13H,1H2,2H3/p-1 |
| InChIKey | YKZMYRYLNHVBMC-UHFFFAOYSA-M |
| XLogP | 1.43 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.22 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|