About methyl 2-(4-oxo-1,3-thiazolidin-2-ylidene)acetate
methyl 2-(4-oxo-1,3-thiazolidin-2-ylidene)acetate (PubChem CID 599229) has the molecular formula C6H7NO3S
and a molecular weight of 173.19 g/mol. Its IUPAC name is methyl 2-(4-oxo-1,3-thiazolidin-2-ylidene)acetate.
Molecular Properties
| Compound Name | methyl 2-(4-oxo-1,3-thiazolidin-2-ylidene)acetate |
| PubChem CID | 599229 |
| Molecular Formula | C6H7NO3S |
| Molecular Weight | 173.19 g/mol |
| Exact Mass | 173.01 |
| IUPAC Name | methyl 2-(4-oxo-1,3-thiazolidin-2-ylidene)acetate |
| SMILES | COC(=O)C=C1NC(=O)CS1 |
| InChI | InChI=1S/C6H7NO3S/c1-10-6(9)2-5-7-4(8)3-11-5/h2H,3H2,1H3,(H,7,8) |
| InChIKey | YERBFSSSKXIGIJ-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.19 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-(4-oxo-1,3-thiazolidin-2-ylidene)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(4-oxo-1,3-thiazolidin-2-ylidene)acetate?
The IUPAC name of methyl 2-(4-oxo-1,3-thiazolidin-2-ylidene)acetate (CID 599229) is methyl 2-(4-oxo-1,3-thiazolidin-2-ylidene)acetate.
What is the SMILES notation for methyl 2-(4-oxo-1,3-thiazolidin-2-ylidene)acetate?
The canonical SMILES for methyl 2-(4-oxo-1,3-thiazolidin-2-ylidene)acetate is COC(=O)C=C1NC(=O)CS1.
What is the InChIKey of methyl 2-(4-oxo-1,3-thiazolidin-2-ylidene)acetate?
The InChIKey is YERBFSSSKXIGIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO3S/c1-10-6(9)2-5-7-4(8)3-11-5/h2H,3H2,1H3,(H,7,8).
What are the key properties of methyl 2-(4-oxo-1,3-thiazolidin-2-ylidene)acetate?
methyl 2-(4-oxo-1,3-thiazolidin-2-ylidene)acetate has a molecular weight of 173.19 g/mol, XLogP of -0.14, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(4-oxo-1,3-thiazolidin-2-ylidene)acetate is sourced from PubChem (CID 599229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).