About [4-[(E)-2,3-dimethylbut-1-enyl]-1,3-thiazol-2-yl]methanamine
[4-[(E)-2,3-dimethylbut-1-enyl]-1,3-thiazol-2-yl]methanamine (PubChem CID 59922924) has the molecular formula C10H16N2S
and a molecular weight of 196.32 g/mol. Its IUPAC name is [4-[(E)-2,3-dimethylbut-1-enyl]-1,3-thiazol-2-yl]methanamine.
Molecular Properties
| Compound Name | [4-[(E)-2,3-dimethylbut-1-enyl]-1,3-thiazol-2-yl]methanamine |
| PubChem CID | 59922924 |
| Molecular Formula | C10H16N2S |
| Molecular Weight | 196.32 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | [4-[(E)-2,3-dimethylbut-1-enyl]-1,3-thiazol-2-yl]methanamine |
| SMILES | C/C(=C\c1csc(CN)n1)C(C)C |
| InChI | InChI=1S/C10H16N2S/c1-7(2)8(3)4-9-6-13-10(5-11)12-9/h4,6-7H,5,11H2,1-3H3/b8-4+ |
| InChIKey | COMPHEOKIRBSIK-XBXARRHUSA-N |
| XLogP | 2.66 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-[(E)-2,3-dimethylbut-1-enyl]-1,3-thiazol-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(E)-2,3-dimethylbut-1-enyl]-1,3-thiazol-2-yl]methanamine?
The IUPAC name of [4-[(E)-2,3-dimethylbut-1-enyl]-1,3-thiazol-2-yl]methanamine (CID 59922924) is [4-[(E)-2,3-dimethylbut-1-enyl]-1,3-thiazol-2-yl]methanamine.
What is the SMILES notation for [4-[(E)-2,3-dimethylbut-1-enyl]-1,3-thiazol-2-yl]methanamine?
The canonical SMILES for [4-[(E)-2,3-dimethylbut-1-enyl]-1,3-thiazol-2-yl]methanamine is C/C(=C\c1csc(CN)n1)C(C)C.
What is the InChIKey of [4-[(E)-2,3-dimethylbut-1-enyl]-1,3-thiazol-2-yl]methanamine?
The InChIKey is COMPHEOKIRBSIK-XBXARRHUSA-N. The full InChI is InChI=1S/C10H16N2S/c1-7(2)8(3)4-9-6-13-10(5-11)12-9/h4,6-7H,5,11H2,1-3H3/b8-4+.
What are the key properties of [4-[(E)-2,3-dimethylbut-1-enyl]-1,3-thiazol-2-yl]methanamine?
[4-[(E)-2,3-dimethylbut-1-enyl]-1,3-thiazol-2-yl]methanamine has a molecular weight of 196.32 g/mol, XLogP of 2.66, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(E)-2,3-dimethylbut-1-enyl]-1,3-thiazol-2-yl]methanamine is sourced from PubChem (CID 59922924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).