C13H14NNaO3 — CID 59922987
sodium (1E,8aS,8bR)-1-ethylidene-2-oxo-5,6,7,8,8a,8b-hexahydroazeto[1,2-b]isoindole-4-carboxylate (PubChem CID 59922987) has the molecular formula C13H14NNaO3 and a molecular weight of 255.25 g/mol. Its IUPAC name is sodium (1E,8aS,8bR)-1-ethylidene-2-oxo-5,6,7,8,8a,8b-hexahydroazeto[1,2-b]isoindole-4-carboxylate.
| Compound Name | sodium (1E,8aS,8bR)-1-ethylidene-2-oxo-5,6,7,8,8a,8b-hexahydroazeto[1,2-b]isoindole-4-carboxylate |
|---|---|
| PubChem CID | 59922987 |
| Molecular Formula | C13H14NNaO3 |
| Molecular Weight | 255.25 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | sodium (1E,8aS,8bR)-1-ethylidene-2-oxo-5,6,7,8,8a,8b-hexahydroazeto[1,2-b]isoindole-4-carboxylate |
| SMILES | C/C=C1/C(=O)N2C(C(=O)[O-])=C3CCCC[C@@H]3[C@H]12.[Na+] |
| InChI | InChI=1S/C13H15NO3.Na/c1-2-7-10-8-5-3-4-6-9(8)11(13(16)17)14(10)12(7)15;/h2,8,10H,3-6H2,1H3,(H,16,17);/q;+1/p-1/b7-2+;/t8-,10-;/m0./s1 |
| InChIKey | YHNUIRDTHGTRAL-UMSKDSPTSA-M |
| XLogP | -2.64 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.25 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|