About carbanide;methyl 3-[[2-[acetyl(methyl)amino]acetyl]amino]-2-methylbutanoate;yttrium
carbanide;methyl 3-[[2-[acetyl(methyl)amino]acetyl]amino]-2-methylbutanoate;yttrium (PubChem CID 59923041) has the molecular formula C12H22N2O4Y-2
and a molecular weight of 347.22 g/mol. Its IUPAC name is carbanide;methyl 3-[[2-[acetyl(methyl)amino]acetyl]amino]-2-methylbutanoate;yttrium.
Molecular Properties
| Compound Name | carbanide;methyl 3-[[2-[acetyl(methyl)amino]acetyl]amino]-2-methylbutanoate;yttrium |
| PubChem CID | 59923041 |
| Molecular Formula | C12H22N2O4Y-2 |
| Molecular Weight | 347.22 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | carbanide;methyl 3-[[2-[acetyl(methyl)amino]acetyl]amino]-2-methylbutanoate;yttrium |
| SMILES | [CH2-]C(=O)N(C)CC(=O)NC(C)C(C)C(=O)OC.[CH3-].[Y] |
| InChI | InChI=1S/C11H19N2O4.CH3.Y/c1-7(11(16)17-5)8(2)12-10(15)6-13(4)9(3)14;;/h7-8H,3,6H2,1-2,4-5H3,(H,12,15);1H3;/q2*-1; |
| InChIKey | JGULHRDHGPNQEM-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.22 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;methyl 3-[[2-[acetyl(methyl)amino]acetyl]amino]-2-methylbutanoate;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;methyl 3-[[2-[acetyl(methyl)amino]acetyl]amino]-2-methylbutanoate;yttrium?
The IUPAC name of carbanide;methyl 3-[[2-[acetyl(methyl)amino]acetyl]amino]-2-methylbutanoate;yttrium (CID 59923041) is carbanide;methyl 3-[[2-[acetyl(methyl)amino]acetyl]amino]-2-methylbutanoate;yttrium.
What is the SMILES notation for carbanide;methyl 3-[[2-[acetyl(methyl)amino]acetyl]amino]-2-methylbutanoate;yttrium?
The canonical SMILES for carbanide;methyl 3-[[2-[acetyl(methyl)amino]acetyl]amino]-2-methylbutanoate;yttrium is [CH2-]C(=O)N(C)CC(=O)NC(C)C(C)C(=O)OC.[CH3-].[Y].
What is the InChIKey of carbanide;methyl 3-[[2-[acetyl(methyl)amino]acetyl]amino]-2-methylbutanoate;yttrium?
The InChIKey is JGULHRDHGPNQEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N2O4.CH3.Y/c1-7(11(16)17-5)8(2)12-10(15)6-13(4)9(3)14;;/h7-8H,3,6H2,1-2,4-5H3,(H,12,15);1H3;/q2*-1;.
What are the key properties of carbanide;methyl 3-[[2-[acetyl(methyl)amino]acetyl]amino]-2-methylbutanoate;yttrium?
carbanide;methyl 3-[[2-[acetyl(methyl)amino]acetyl]amino]-2-methylbutanoate;yttrium has a molecular weight of 347.22 g/mol, XLogP of 0.04, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;methyl 3-[[2-[acetyl(methyl)amino]acetyl]amino]-2-methylbutanoate;yttrium is sourced from PubChem (CID 59923041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).