About CID 59923299
CID 59923299 (PubChem CID 59923299) has the molecular formula C6H11B2O2
and a molecular weight of 136.78 g/mol.
Molecular Properties
| Compound Name | CID 59923299 |
| PubChem CID | 59923299 |
| Molecular Formula | C6H11B2O2 |
| Molecular Weight | 136.78 g/mol |
| Exact Mass | 137.09 |
| IUPAC Name | — |
| SMILES | [B][B]COC(=O)C(C)CC |
| InChI | InChI=1S/C6H11B2O2/c1-3-5(2)6(9)10-4-8-7/h5H,3-4H2,1-2H3 |
| InChIKey | PSOWQPQETTZPPN-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.78 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 59923299 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59923299?
The IUPAC name of CID 59923299 (CID 59923299) is not available.
What is the SMILES notation for CID 59923299?
The canonical SMILES for CID 59923299 is [B][B]COC(=O)C(C)CC.
What is the InChIKey of CID 59923299?
The InChIKey is PSOWQPQETTZPPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11B2O2/c1-3-5(2)6(9)10-4-8-7/h5H,3-4H2,1-2H3.
What are the key properties of CID 59923299?
CID 59923299 has a molecular weight of 136.78 g/mol, XLogP of 0.32, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59923299 is sourced from PubChem (CID 59923299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).