C19H14BrCl2N3O4S — CID 59923705
(5R)-5-[(4-bromophenyl)methyl]-7-(3,5-dichlorophenyl)-5-methyl-6-oxoimidazo[1,2-a]imidazole-3-sulfonic acid (PubChem CID 59923705) has the molecular formula C19H14BrCl2N3O4S and a molecular weight of 531.22 g/mol. Its IUPAC name is (5R)-5-[(4-bromophenyl)methyl]-7-(3,5-dichlorophenyl)-5-methyl-6-oxoimidazo[1,2-a]imidazole-3-sulfonic acid.
| Compound Name | (5R)-5-[(4-bromophenyl)methyl]-7-(3,5-dichlorophenyl)-5-methyl-6-oxoimidazo[1,2-a]imidazole-3-sulfonic acid |
|---|---|
| PubChem CID | 59923705 |
| Molecular Formula | C19H14BrCl2N3O4S |
| Molecular Weight | 531.22 g/mol |
| Exact Mass | 528.93 |
| IUPAC Name | (5R)-5-[(4-bromophenyl)methyl]-7-(3,5-dichlorophenyl)-5-methyl-6-oxoimidazo[1,2-a]imidazole-3-sulfonic acid |
| SMILES | C[C@@]1(Cc2ccc(Br)cc2)C(=O)N(c2cc(Cl)cc(Cl)c2)c2ncc(S(=O)(=O)O)n21 |
| InChI | InChI=1S/C19H14BrCl2N3O4S/c1-19(9-11-2-4-12(20)5-3-11)17(26)24(15-7-13(21)6-14(22)8-15)18-23-10-16(25(18)19)30(27,28)29/h2-8,10H,9H2,1H3,(H,27,28,29)/t19-/m1/s1 |
| InChIKey | MJUNZKBMSAKRSA-LJQANCHMSA-N |
| XLogP | 4.84 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.22 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|