C13H13O4W5Y4-3 — CID 59925096
(6-hydroxy-7-methyl-3,4,5,8-tetrahydrochromene-2,5,8-triid-2-yl)methyl acetate;tungsten;tetrakis(yttrium) (PubChem CID 59925096) has the molecular formula C13H13O4W5Y4-3 and a molecular weight of 1508.07 g/mol. Its IUPAC name is (6-hydroxy-7-methyl-3,4,5,8-tetrahydrochromene-2,5,8-triid-2-yl)methyl acetate;tungsten;tetrakis(yttrium).
| Compound Name | (6-hydroxy-7-methyl-3,4,5,8-tetrahydrochromene-2,5,8-triid-2-yl)methyl acetate;tungsten;tetrakis(yttrium) |
|---|---|
| PubChem CID | 59925096 |
| Molecular Formula | C13H13O4W5Y4-3 |
| Molecular Weight | 1508.07 g/mol |
| Exact Mass | 1508.46 |
| IUPAC Name | (6-hydroxy-7-methyl-3,4,5,8-tetrahydrochromene-2,5,8-triid-2-yl)methyl acetate;tungsten;tetrakis(yttrium) |
| SMILES | CC(=O)OC[C-]1CCc2[c-]c(O)c(C)[c-]c2O1.[W].[W].[W].[W].[W].[Y].[Y].[Y].[Y] |
| InChI | InChI=1S/C13H13O4.5W.4Y/c1-8-5-13-10(6-12(8)15)3-4-11(17-13)7-16-9(2)14;;;;;;;;;/h15H,3-4,7H2,1-2H3;;;;;;;;;/q-3;;;;;;;;; |
| InChIKey | BAJFXRVMAISKGI-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 1508.07 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|