About 6-tert-butyl-8-methyl-1,3-benzodioxin-4-one
6-tert-butyl-8-methyl-1,3-benzodioxin-4-one (PubChem CID 59926200) has the molecular formula C13H16O3
and a molecular weight of 220.27 g/mol. Its IUPAC name is 6-tert-butyl-8-methyl-1,3-benzodioxin-4-one.
Molecular Properties
| Compound Name | 6-tert-butyl-8-methyl-1,3-benzodioxin-4-one |
| PubChem CID | 59926200 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 6-tert-butyl-8-methyl-1,3-benzodioxin-4-one |
| SMILES | Cc1cc(C(C)(C)C)cc2c1OCOC2=O |
| InChI | InChI=1S/C13H16O3/c1-8-5-9(13(2,3)4)6-10-11(8)15-7-16-12(10)14/h5-6H,7H2,1-4H3 |
| InChIKey | RYOCWBXYFPWCDX-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-tert-butyl-8-methyl-1,3-benzodioxin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-8-methyl-1,3-benzodioxin-4-one?
The IUPAC name of 6-tert-butyl-8-methyl-1,3-benzodioxin-4-one (CID 59926200) is 6-tert-butyl-8-methyl-1,3-benzodioxin-4-one.
What is the SMILES notation for 6-tert-butyl-8-methyl-1,3-benzodioxin-4-one?
The canonical SMILES for 6-tert-butyl-8-methyl-1,3-benzodioxin-4-one is Cc1cc(C(C)(C)C)cc2c1OCOC2=O.
What is the InChIKey of 6-tert-butyl-8-methyl-1,3-benzodioxin-4-one?
The InChIKey is RYOCWBXYFPWCDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O3/c1-8-5-9(13(2,3)4)6-10-11(8)15-7-16-12(10)14/h5-6H,7H2,1-4H3.
What are the key properties of 6-tert-butyl-8-methyl-1,3-benzodioxin-4-one?
6-tert-butyl-8-methyl-1,3-benzodioxin-4-one has a molecular weight of 220.27 g/mol, XLogP of 2.80, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-8-methyl-1,3-benzodioxin-4-one is sourced from PubChem (CID 59926200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).