C25H38O — CID 59926362
1,3-ditert-butyl-2-ethoxy-5-[(2E,4E,6E)-6-methylocta-2,4,6-trien-2-yl]benzene (PubChem CID 59926362) has the molecular formula C25H38O and a molecular weight of 354.58 g/mol. Its IUPAC name is 1,3-ditert-butyl-2-ethoxy-5-[(2E,4E,6E)-6-methylocta-2,4,6-trien-2-yl]benzene.
| Compound Name | 1,3-ditert-butyl-2-ethoxy-5-[(2E,4E,6E)-6-methylocta-2,4,6-trien-2-yl]benzene |
|---|---|
| PubChem CID | 59926362 |
| Molecular Formula | C25H38O |
| Molecular Weight | 354.58 g/mol |
| Exact Mass | 354.29 |
| IUPAC Name | 1,3-ditert-butyl-2-ethoxy-5-[(2E,4E,6E)-6-methylocta-2,4,6-trien-2-yl]benzene |
| SMILES | C/C=C(C)/C=C/C=C(\C)c1cc(C(C)(C)C)c(OCC)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C25H38O/c1-11-18(3)14-13-15-19(4)20-16-21(24(5,6)7)23(26-12-2)22(17-20)25(8,9)10/h11,13-17H,12H2,1-10H3/b14-13+,18-11+,19-15+ |
| InChIKey | AQDAXSCIEQDRPG-YPUIWNNRSA-N |
| XLogP | 7.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.58 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|