About 5-iodo-2-methoxyoxane
5-iodo-2-methoxyoxane (PubChem CID 59927245) has the molecular formula C6H11IO2
and a molecular weight of 242.06 g/mol. Its IUPAC name is 5-iodo-2-methoxyoxane.
Molecular Properties
| Compound Name | 5-iodo-2-methoxyoxane |
| PubChem CID | 59927245 |
| Molecular Formula | C6H11IO2 |
| Molecular Weight | 242.06 g/mol |
| Exact Mass | 241.98 |
| IUPAC Name | 5-iodo-2-methoxyoxane |
| SMILES | COC1CCC(I)CO1 |
| InChI | InChI=1S/C6H11IO2/c1-8-6-3-2-5(7)4-9-6/h5-6H,2-4H2,1H3 |
| InChIKey | UPGBGMFCKPAOKF-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.06 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-iodo-2-methoxyoxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodo-2-methoxyoxane?
The IUPAC name of 5-iodo-2-methoxyoxane (CID 59927245) is 5-iodo-2-methoxyoxane.
What is the SMILES notation for 5-iodo-2-methoxyoxane?
The canonical SMILES for 5-iodo-2-methoxyoxane is COC1CCC(I)CO1.
What is the InChIKey of 5-iodo-2-methoxyoxane?
The InChIKey is UPGBGMFCKPAOKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11IO2/c1-8-6-3-2-5(7)4-9-6/h5-6H,2-4H2,1H3.
What are the key properties of 5-iodo-2-methoxyoxane?
5-iodo-2-methoxyoxane has a molecular weight of 242.06 g/mol, XLogP of 1.57, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodo-2-methoxyoxane is sourced from PubChem (CID 59927245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).