C8H5O6+ — CID 59927400
(5,8,10-trioxo-4,9-dioxatricyclo[5.3.0.02,6]decan-3-ylidene)oxidanium (PubChem CID 59927400) has the molecular formula C8H5O6+ and a molecular weight of 197.12 g/mol. Its IUPAC name is (5,8,10-trioxo-4,9-dioxatricyclo[5.3.0.02,6]decan-3-ylidene)oxidanium.
| Compound Name | (5,8,10-trioxo-4,9-dioxatricyclo[5.3.0.02,6]decan-3-ylidene)oxidanium |
|---|---|
| PubChem CID | 59927400 |
| Molecular Formula | C8H5O6+ |
| Molecular Weight | 197.12 g/mol |
| Exact Mass | 197.01 |
| IUPAC Name | (5,8,10-trioxo-4,9-dioxatricyclo[5.3.0.02,6]decan-3-ylidene)oxidanium |
| SMILES | [H]/[O+]=C1\OC(=O)C2C3C(=O)OC(=O)C3C12 |
| InChI | InChI=1S/C8H4O6/c9-5-1-2(6(10)13-5)4-3(1)7(11)14-8(4)12/h1-4H/p+1 |
| InChIKey | YGYCECQIOXZODZ-UHFFFAOYSA-O |
| XLogP | -1.39 |
| TPSA | 91.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.12 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|