C28H33ClN4O2S — CID 59927675
13-chloro-9-(3-imidazol-1-yl-3-methylbutyl)-2-(1-methylsulfonylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene (PubChem CID 59927675) has the molecular formula C28H33ClN4O2S and a molecular weight of 525.12 g/mol. Its IUPAC name is 13-chloro-9-(3-imidazol-1-yl-3-methylbutyl)-2-(1-methylsulfonylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene.
| Compound Name | 13-chloro-9-(3-imidazol-1-yl-3-methylbutyl)-2-(1-methylsulfonylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene |
|---|---|
| PubChem CID | 59927675 |
| Molecular Formula | C28H33ClN4O2S |
| Molecular Weight | 525.12 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | 13-chloro-9-(3-imidazol-1-yl-3-methylbutyl)-2-(1-methylsulfonylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene |
| SMILES | CC(C)(CCC1=Cc2cc(Cl)ccc2C(C2CCN(S(C)(=O)=O)CC2)c2ncccc21)n1ccnc1 |
| InChI | InChI=1S/C28H33ClN4O2S/c1-28(2,32-16-13-30-19-32)11-8-21-17-22-18-23(29)6-7-24(22)26(27-25(21)5-4-12-31-27)20-9-14-33(15-10-20)36(3,34)35/h4-7,12-13,16-20,26H,8-11,14-15H2,1-3H3 |
| InChIKey | HWOYCZQEOGWQBX-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.12 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |