About (E)-2,3-difluorobut-2-ene
(E)-2,3-difluorobut-2-ene (PubChem CID 59928419) has the molecular formula C4H6F2
and a molecular weight of 92.09 g/mol. Its IUPAC name is (E)-2,3-difluorobut-2-ene.
Molecular Properties
| Compound Name | (E)-2,3-difluorobut-2-ene |
| PubChem CID | 59928419 |
| Molecular Formula | C4H6F2 |
| Molecular Weight | 92.09 g/mol |
| Exact Mass | 92.04 |
| IUPAC Name | (E)-2,3-difluorobut-2-ene |
| SMILES | C/C(F)=C(/C)F |
| InChI | InChI=1S/C4H6F2/c1-3(5)4(2)6/h1-2H3/b4-3+ |
| InChIKey | VPIRIYLZPMUDIR-ONEGZZNKSA-N |
| XLogP | 2.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 92.09 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (E)-2,3-difluorobut-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2,3-difluorobut-2-ene?
The IUPAC name of (E)-2,3-difluorobut-2-ene (CID 59928419) is (E)-2,3-difluorobut-2-ene.
What is the SMILES notation for (E)-2,3-difluorobut-2-ene?
The canonical SMILES for (E)-2,3-difluorobut-2-ene is C/C(F)=C(/C)F.
What is the InChIKey of (E)-2,3-difluorobut-2-ene?
The InChIKey is VPIRIYLZPMUDIR-ONEGZZNKSA-N. The full InChI is InChI=1S/C4H6F2/c1-3(5)4(2)6/h1-2H3/b4-3+.
What are the key properties of (E)-2,3-difluorobut-2-ene?
(E)-2,3-difluorobut-2-ene has a molecular weight of 92.09 g/mol, XLogP of 2.18, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,3-difluorobut-2-ene is sourced from PubChem (CID 59928419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).