C23H46N2O2S2 — CID 59929298
3,3,7,7-tetramethyl-N,N'-bis(2-propylsulfanylethyl)nonanediamide (PubChem CID 59929298) has the molecular formula C23H46N2O2S2 and a molecular weight of 446.77 g/mol. Its IUPAC name is 3,3,7,7-tetramethyl-N,N'-bis(2-propylsulfanylethyl)nonanediamide.
| Compound Name | 3,3,7,7-tetramethyl-N,N'-bis(2-propylsulfanylethyl)nonanediamide |
|---|---|
| PubChem CID | 59929298 |
| Molecular Formula | C23H46N2O2S2 |
| Molecular Weight | 446.77 g/mol |
| Exact Mass | 446.30 |
| IUPAC Name | 3,3,7,7-tetramethyl-N,N'-bis(2-propylsulfanylethyl)nonanediamide |
| SMILES | CCCSCCNC(=O)CC(C)(C)CCCC(C)(C)CC(=O)NCCSCCC |
| InChI | InChI=1S/C23H46N2O2S2/c1-7-14-28-16-12-24-20(26)18-22(3,4)10-9-11-23(5,6)19-21(27)25-13-17-29-15-8-2/h7-19H2,1-6H3,(H,24,26)(H,25,27) |
| InChIKey | CTLRTEFZDIWTAM-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.77 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|