C19H29N2+ — CID 59929322
methyl-[5,6,7,9-tetramethyl-13-(methylamino)trideca-2,4,6,8,10,12-hexaenylidene]azanium (PubChem CID 59929322) has the molecular formula C19H29N2+ and a molecular weight of 285.46 g/mol. Its IUPAC name is methyl-[5,6,7,9-tetramethyl-13-(methylamino)trideca-2,4,6,8,10,12-hexaenylidene]azanium.
| Compound Name | methyl-[5,6,7,9-tetramethyl-13-(methylamino)trideca-2,4,6,8,10,12-hexaenylidene]azanium |
|---|---|
| PubChem CID | 59929322 |
| Molecular Formula | C19H29N2+ |
| Molecular Weight | 285.46 g/mol |
| Exact Mass | 285.23 |
| IUPAC Name | methyl-[5,6,7,9-tetramethyl-13-(methylamino)trideca-2,4,6,8,10,12-hexaenylidene]azanium |
| SMILES | CNC=CC=CC(C)=CC(C)=C(C)C(C)=CC=C/C=[NH+]/C |
| InChI | InChI=1S/C19H28N2/c1-16(11-7-9-13-20-5)15-18(3)19(4)17(2)12-8-10-14-21-6/h7-15,20H,1-6H3/p+1/b10-8?,11-7?,13-9?,16-15?,17-12?,19-18?,21-14+ |
| InChIKey | GJYJIUMTYRKJOW-DVRARELZSA-O |
| XLogP | 2.84 |
| TPSA | 26.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.46 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|