C16H25N2+ — CID 59929349
methyl-[5,6,7-trimethyl-11-(methylamino)undeca-2,4,6,8,10-pentaenylidene]azanium (PubChem CID 59929349) has the molecular formula C16H25N2+ and a molecular weight of 245.39 g/mol. Its IUPAC name is methyl-[5,6,7-trimethyl-11-(methylamino)undeca-2,4,6,8,10-pentaenylidene]azanium.
| Compound Name | methyl-[5,6,7-trimethyl-11-(methylamino)undeca-2,4,6,8,10-pentaenylidene]azanium |
|---|---|
| PubChem CID | 59929349 |
| Molecular Formula | C16H25N2+ |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.20 |
| IUPAC Name | methyl-[5,6,7-trimethyl-11-(methylamino)undeca-2,4,6,8,10-pentaenylidene]azanium |
| SMILES | CNC=CC=CC(C)=C(C)C(C)=CC=C/C=[NH+]/C |
| InChI | InChI=1S/C16H24N2/c1-14(10-6-8-12-17-4)16(3)15(2)11-7-9-13-18-5/h6-13,17H,1-5H3/p+1/b9-7?,10-6?,12-8?,15-11?,16-14?,18-13+ |
| InChIKey | ZYQBKKBTFDLFJK-IBXVOGMMSA-O |
| XLogP | 1.90 |
| TPSA | 26.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|