C10H9N — CID 59929764
N-methylnona-2,3,4,5,6,7,8-heptaen-2-amine (PubChem CID 59929764) has the molecular formula C10H9N and a molecular weight of 143.19 g/mol. Its IUPAC name is N-methylnona-2,3,4,5,6,7,8-heptaen-2-amine.
| Compound Name | N-methylnona-2,3,4,5,6,7,8-heptaen-2-amine |
|---|---|
| PubChem CID | 59929764 |
| Molecular Formula | C10H9N |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.07 |
| IUPAC Name | N-methylnona-2,3,4,5,6,7,8-heptaen-2-amine |
| SMILES | C=C=C=C=C=C=C=C(C)NC |
| InChI | InChI=1S/C10H9N/c1-4-5-6-7-8-9-10(2)11-3/h11H,1H2,2-3H3 |
| InChIKey | YMGZHRPQDVEZKB-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |