About 3,9-diazaspiro[5.5]undeca-2,4-diene
3,9-diazaspiro[5.5]undeca-2,4-diene (PubChem CID 59929934) has the molecular formula C9H14N2
and a molecular weight of 150.23 g/mol. Its IUPAC name is 3,9-diazaspiro[5.5]undeca-2,4-diene.
Molecular Properties
| Compound Name | 3,9-diazaspiro[5.5]undeca-2,4-diene |
| PubChem CID | 59929934 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.23 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 3,9-diazaspiro[5.5]undeca-2,4-diene |
| SMILES | C1=CC2(CC=N1)CCNCC2 |
| InChI | InChI=1S/C9H14N2/c1-5-10-6-2-9(1)3-7-11-8-4-9/h1,5-6,11H,2-4,7-8H2 |
| InChIKey | TWFPBEKXFVBZIA-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.23 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,9-diazaspiro[5.5]undeca-2,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,9-diazaspiro[5.5]undeca-2,4-diene?
The IUPAC name of 3,9-diazaspiro[5.5]undeca-2,4-diene (CID 59929934) is 3,9-diazaspiro[5.5]undeca-2,4-diene.
What is the SMILES notation for 3,9-diazaspiro[5.5]undeca-2,4-diene?
The canonical SMILES for 3,9-diazaspiro[5.5]undeca-2,4-diene is C1=CC2(CC=N1)CCNCC2.
What is the InChIKey of 3,9-diazaspiro[5.5]undeca-2,4-diene?
The InChIKey is TWFPBEKXFVBZIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2/c1-5-10-6-2-9(1)3-7-11-8-4-9/h1,5-6,11H,2-4,7-8H2.
What are the key properties of 3,9-diazaspiro[5.5]undeca-2,4-diene?
3,9-diazaspiro[5.5]undeca-2,4-diene has a molecular weight of 150.23 g/mol, XLogP of 1.34, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,9-diazaspiro[5.5]undeca-2,4-diene is sourced from PubChem (CID 59929934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).