About CID 59930594
CID 59930594 (PubChem CID 59930594) has the molecular formula C5H16O3Si3
and a molecular weight of 208.44 g/mol.
Molecular Properties
| Compound Name | CID 59930594 |
| PubChem CID | 59930594 |
| Molecular Formula | C5H16O3Si3 |
| Molecular Weight | 208.44 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | — |
| SMILES | CO[Si](C)(C)O[SiH](C)O[Si]C |
| InChI | InChI=1S/C5H16O3Si3/c1-6-11(4,5)8-10(3)7-9-2/h10H,1-5H3 |
| InChIKey | JUKXDRCOAGLJQB-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.44 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 59930594 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59930594?
The IUPAC name of CID 59930594 (CID 59930594) is not available.
What is the SMILES notation for CID 59930594?
The canonical SMILES for CID 59930594 is CO[Si](C)(C)O[SiH](C)O[Si]C.
What is the InChIKey of CID 59930594?
The InChIKey is JUKXDRCOAGLJQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H16O3Si3/c1-6-11(4,5)8-10(3)7-9-2/h10H,1-5H3.
What are the key properties of CID 59930594?
CID 59930594 has a molecular weight of 208.44 g/mol, XLogP of 0.89, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59930594 is sourced from PubChem (CID 59930594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).