C9H15P — CID 59930622
(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)phosphane (PubChem CID 59930622) has the molecular formula C9H15P and a molecular weight of 154.19 g/mol. Its IUPAC name is (2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)phosphane.
| Compound Name | (2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)phosphane |
|---|---|
| PubChem CID | 59930622 |
| Molecular Formula | C9H15P |
| Molecular Weight | 154.19 g/mol |
| Exact Mass | 154.09 |
| IUPAC Name | (2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)phosphane |
| SMILES | CC1=C(C)C(P)C(C)=C1C |
| InChI | InChI=1S/C9H15P/c1-5-6(2)8(4)9(10)7(5)3/h9H,10H2,1-4H3 |
| InChIKey | DGMGNATXPITBKJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.19 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|