C20H32AcO3 — CID 59930677
actinium;(5R)-2,8,12-trimethyl-5-propan-2-yl-15-oxatricyclo[10.2.1.04,9]pentadeca-7,13-diene-1,11-diol (PubChem CID 59930677) has the molecular formula C20H32AcO3 and a molecular weight of 547.47 g/mol. Its IUPAC name is actinium;(5R)-2,8,12-trimethyl-5-propan-2-yl-15-oxatricyclo[10.2.1.04,9]pentadeca-7,13-diene-1,11-diol.
| Compound Name | actinium;(5R)-2,8,12-trimethyl-5-propan-2-yl-15-oxatricyclo[10.2.1.04,9]pentadeca-7,13-diene-1,11-diol |
|---|---|
| PubChem CID | 59930677 |
| Molecular Formula | C20H32AcO3 |
| Molecular Weight | 547.47 g/mol |
| Exact Mass | 547.26 |
| IUPAC Name | actinium;(5R)-2,8,12-trimethyl-5-propan-2-yl-15-oxatricyclo[10.2.1.04,9]pentadeca-7,13-diene-1,11-diol |
| SMILES | CC1=CC[C@H](C(C)C)C2CC(C)C3(O)C=CC(C)(O3)C(O)CC12.[Ac] |
| InChI | InChI=1S/C20H32O3.Ac/c1-12(2)15-7-6-13(3)16-11-18(21)19(5)8-9-20(22,23-19)14(4)10-17(15)16;/h6,8-9,12,14-18,21-22H,7,10-11H2,1-5H3;/t14?,15-,16?,17?,18?,19?,20?;/m1./s1 |
| InChIKey | BBGUNGWXCQRCQA-JDXSIJRTSA-N |
| XLogP | 3.67 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|