C16H19NO4 — CID 59930731
3-(3-hydroxy-2,4,5,6-tetramethylphenyl)-5-propan-2-ylidene-1,3-oxazolidine-2,4-dione (PubChem CID 59930731) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is 3-(3-hydroxy-2,4,5,6-tetramethylphenyl)-5-propan-2-ylidene-1,3-oxazolidine-2,4-dione.
| Compound Name | 3-(3-hydroxy-2,4,5,6-tetramethylphenyl)-5-propan-2-ylidene-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 59930731 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 3-(3-hydroxy-2,4,5,6-tetramethylphenyl)-5-propan-2-ylidene-1,3-oxazolidine-2,4-dione |
| SMILES | CC(C)=C1OC(=O)N(c2c(C)c(C)c(C)c(O)c2C)C1=O |
| InChI | InChI=1S/C16H19NO4/c1-7(2)14-15(19)17(16(20)21-14)12-9(4)8(3)10(5)13(18)11(12)6/h18H,1-6H3 |
| InChIKey | JDAFDSKUHHDQDR-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|