potassium [acetyl(methyl)amino]methylazanide

C4H9KN2O — CID 59930826

IUPACpotassium [acetyl(methyl)amino]methylazanide
SMILESCC(=O)N(C)C[NH-].[K+]
InChIInChI=1S/C4H9N2O.K/c1-4(7)6(2)3-5;/h5H,3H2,1-2H3;/q-1;+1
InChIKeyKSBJUAAMVHZLKS-UHFFFAOYSA-N
MW140.23 g/mol
LogP-2.52
Rot. Bonds1

About potassium [acetyl(methyl)amino]methylazanide

potassium [acetyl(methyl)amino]methylazanide (PubChem CID 59930826) has the molecular formula C4H9KN2O and a molecular weight of 140.23 g/mol. Its IUPAC name is potassium [acetyl(methyl)amino]methylazanide.

Molecular Properties

Compound Namepotassium [acetyl(methyl)amino]methylazanide
PubChem CID59930826
Molecular FormulaC4H9KN2O
Molecular Weight140.23 g/mol
Exact Mass140.04
IUPAC Namepotassium [acetyl(methyl)amino]methylazanide
SMILESCC(=O)N(C)C[NH-].[K+]
InChIInChI=1S/C4H9N2O.K/c1-4(7)6(2)3-5;/h5H,3H2,1-2H3;/q-1;+1
InChIKeyKSBJUAAMVHZLKS-UHFFFAOYSA-N
XLogP-2.52
TPSA44.11 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms8
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500140.23
LogP ≤ 5-2.52
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Analyze potassium [acetyl(methyl)amino]methylazanide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium [acetyl(methyl)amino]methylazanide?
The IUPAC name of potassium [acetyl(methyl)amino]methylazanide (CID 59930826) is potassium [acetyl(methyl)amino]methylazanide.
What is the SMILES notation for potassium [acetyl(methyl)amino]methylazanide?
The canonical SMILES for potassium [acetyl(methyl)amino]methylazanide is CC(=O)N(C)C[NH-].[K+].
What is the InChIKey of potassium [acetyl(methyl)amino]methylazanide?
The InChIKey is KSBJUAAMVHZLKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N2O.K/c1-4(7)6(2)3-5;/h5H,3H2,1-2H3;/q-1;+1.
What are the key properties of potassium [acetyl(methyl)amino]methylazanide?
potassium [acetyl(methyl)amino]methylazanide has a molecular weight of 140.23 g/mol, XLogP of -2.52, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium [acetyl(methyl)amino]methylazanide is sourced from PubChem (CID 59930826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).