C19H20 — CID 59931513
1-pentyl-4-(2-phenylethynyl)benzene (PubChem CID 59931513) has the molecular formula C19H20 and a molecular weight of 248.37 g/mol. Its IUPAC name is 1-pentyl-4-(2-phenylethynyl)benzene.
| Compound Name | 1-pentyl-4-(2-phenylethynyl)benzene |
|---|---|
| PubChem CID | 59931513 |
| Molecular Formula | C19H20 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 1-pentyl-4-(2-phenylethynyl)benzene |
| SMILES | CCCCCc1ccc(C#Cc2ccccc2)cc1 |
| InChI | InChI=1S/C19H20/c1-2-3-5-8-18-12-15-19(16-13-18)14-11-17-9-6-4-7-10-17/h4,6-7,9-10,12-13,15-16H,2-3,5,8H2,1H3 |
| InChIKey | FZTLFCCNSSIKJL-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|