C26H36N2 — CID 59931545
2,2,4-trimethyl-1-[2-(2,2,4-trimethyl-5,6,7,8-tetrahydroquinolin-1-yl)ethyl]quinoline (PubChem CID 59931545) has the molecular formula C26H36N2 and a molecular weight of 376.59 g/mol. Its IUPAC name is 2,2,4-trimethyl-1-[2-(2,2,4-trimethyl-5,6,7,8-tetrahydroquinolin-1-yl)ethyl]quinoline.
| Compound Name | 2,2,4-trimethyl-1-[2-(2,2,4-trimethyl-5,6,7,8-tetrahydroquinolin-1-yl)ethyl]quinoline |
|---|---|
| PubChem CID | 59931545 |
| Molecular Formula | C26H36N2 |
| Molecular Weight | 376.59 g/mol |
| Exact Mass | 376.29 |
| IUPAC Name | 2,2,4-trimethyl-1-[2-(2,2,4-trimethyl-5,6,7,8-tetrahydroquinolin-1-yl)ethyl]quinoline |
| SMILES | CC1=CC(C)(C)N(CCN2c3ccccc3C(C)=CC2(C)C)C2=C1CCCC2 |
| InChI | InChI=1S/C26H36N2/c1-19-17-25(3,4)27(23-13-9-7-11-21(19)23)15-16-28-24-14-10-8-12-22(24)20(2)18-26(28,5)6/h7,9,11,13,17-18H,8,10,12,14-16H2,1-6H3 |
| InChIKey | UTAOALXNBNSHFY-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.59 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |