C38H31N3O9S3 — CID 59931704
3-[[[4-[bis[4-(3-sulfoanilino)phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]amino]methyl]benzenesulfonic acid (PubChem CID 59931704) has the molecular formula C38H31N3O9S3 and a molecular weight of 769.88 g/mol. Its IUPAC name is 3-[[[4-[bis[4-(3-sulfoanilino)phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]amino]methyl]benzenesulfonic acid.
| Compound Name | 3-[[[4-[bis[4-(3-sulfoanilino)phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]amino]methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 59931704 |
| Molecular Formula | C38H31N3O9S3 |
| Molecular Weight | 769.88 g/mol |
| Exact Mass | 769.12 |
| IUPAC Name | 3-[[[4-[bis[4-(3-sulfoanilino)phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]amino]methyl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1cccc(CN=C2C=CC(=C(c3ccc(Nc4cccc(S(=O)(=O)O)c4)cc3)c3ccc(Nc4cccc(S(=O)(=O)O)c4)cc3)C=C2)c1 |
| InChI | InChI=1S/C38H31N3O9S3/c42-51(43,44)35-7-1-4-26(22-35)25-39-30-16-10-27(11-17-30)38(28-12-18-31(19-13-28)40-33-5-2-8-36(23-33)52(45,46)47)29-14-20-32(21-15-29)41-34-6-3-9-37(24-34)53(48,49)50/h1-24,40-41H,25H2,(H,42,43,44)(H,45,46,47)(H,48,49,50) |
| InChIKey | CRWZKARWIPYSNP-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 199.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.88 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|