C13H24OS — CID 59931986
(3Z,6Z)-10-methoxy-9-methyl-9-methylsulfanyldeca-3,6-diene (PubChem CID 59931986) has the molecular formula C13H24OS and a molecular weight of 228.40 g/mol. Its IUPAC name is (3Z,6Z)-10-methoxy-9-methyl-9-methylsulfanyldeca-3,6-diene.
| Compound Name | (3Z,6Z)-10-methoxy-9-methyl-9-methylsulfanyldeca-3,6-diene |
|---|---|
| PubChem CID | 59931986 |
| Molecular Formula | C13H24OS |
| Molecular Weight | 228.40 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | (3Z,6Z)-10-methoxy-9-methyl-9-methylsulfanyldeca-3,6-diene |
| SMILES | CC/C=C\C/C=C\CC(C)(COC)SC |
| InChI | InChI=1S/C13H24OS/c1-5-6-7-8-9-10-11-13(2,15-4)12-14-3/h6-7,9-10H,5,8,11-12H2,1-4H3/b7-6-,10-9- |
| InChIKey | MTYHQTFBUHAGHW-HZJYTTRNSA-N |
| XLogP | 4.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.40 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|