C11H14O4 — CID 59932058
2,2-dimethyl-1-(3,4,5-trihydroxyphenyl)propan-1-one (PubChem CID 59932058) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is 2,2-dimethyl-1-(3,4,5-trihydroxyphenyl)propan-1-one.
| Compound Name | 2,2-dimethyl-1-(3,4,5-trihydroxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 59932058 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 2,2-dimethyl-1-(3,4,5-trihydroxyphenyl)propan-1-one |
| SMILES | CC(C)(C)C(=O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C11H14O4/c1-11(2,3)10(15)6-4-7(12)9(14)8(13)5-6/h4-5,12-14H,1-3H3 |
| InChIKey | IJMURRVDOFLYEM-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|