C7H8NW- — CID 59932569
4,5-dimethyl-2H-pyridin-2-ide;tungsten (PubChem CID 59932569) has the molecular formula C7H8NW- and a molecular weight of 289.99 g/mol. Its IUPAC name is 4,5-dimethyl-2H-pyridin-2-ide;tungsten.
| Compound Name | 4,5-dimethyl-2H-pyridin-2-ide;tungsten |
|---|---|
| PubChem CID | 59932569 |
| Molecular Formula | C7H8NW- |
| Molecular Weight | 289.99 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | 4,5-dimethyl-2H-pyridin-2-ide;tungsten |
| SMILES | Cc1c[c-]ncc1C.[W] |
| InChI | InChI=1S/C7H8N.W/c1-6-3-4-8-5-7(6)2;/h3,5H,1-2H3;/q-1; |
| InChIKey | DUDWPQBUGHSFNE-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.99 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|