C18H34N2O3 — CID 59932833
3-(2-hydroxybutyl)-2,2,7,7,8,9,9-heptamethyl-1-oxa-3,8-diazaspiro[4.5]decan-4-one (PubChem CID 59932833) has the molecular formula C18H34N2O3 and a molecular weight of 326.48 g/mol. Its IUPAC name is 3-(2-hydroxybutyl)-2,2,7,7,8,9,9-heptamethyl-1-oxa-3,8-diazaspiro[4.5]decan-4-one.
| Compound Name | 3-(2-hydroxybutyl)-2,2,7,7,8,9,9-heptamethyl-1-oxa-3,8-diazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 59932833 |
| Molecular Formula | C18H34N2O3 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.26 |
| IUPAC Name | 3-(2-hydroxybutyl)-2,2,7,7,8,9,9-heptamethyl-1-oxa-3,8-diazaspiro[4.5]decan-4-one |
| SMILES | CCC(O)CN1C(=O)C2(CC(C)(C)N(C)C(C)(C)C2)OC1(C)C |
| InChI | InChI=1S/C18H34N2O3/c1-9-13(21)10-20-14(22)18(23-17(20,6)7)11-15(2,3)19(8)16(4,5)12-18/h13,21H,9-12H2,1-8H3 |
| InChIKey | ISAQQWOVNQIQBD-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |