C10H20O4Si — CID 59932901
2,2,6,7-tetramethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasilin-8-ol (PubChem CID 59932901) has the molecular formula C10H20O4Si and a molecular weight of 232.35 g/mol. Its IUPAC name is 2,2,6,7-tetramethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasilin-8-ol.
| Compound Name | 2,2,6,7-tetramethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasilin-8-ol |
|---|---|
| PubChem CID | 59932901 |
| Molecular Formula | C10H20O4Si |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 2,2,6,7-tetramethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasilin-8-ol |
| SMILES | CC1OC2CO[Si](C)(C)OC2C(O)C1C |
| InChI | InChI=1S/C10H20O4Si/c1-6-7(2)13-8-5-12-15(3,4)14-10(8)9(6)11/h6-11H,5H2,1-4H3 |
| InChIKey | DTEIAMXWWGKFIJ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|