C20H24Cl2NO2P — CID 59932910
2-[4-chloro-5-[2-chloro-2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-2-methylphenyl]-4,5,6,7-tetrahydroisoindole-1,3-dione (PubChem CID 59932910) has the molecular formula C20H24Cl2NO2P and a molecular weight of 412.30 g/mol. Its IUPAC name is 2-[4-chloro-5-[2-chloro-2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-2-methylphenyl]-4,5,6,7-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-[4-chloro-5-[2-chloro-2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-2-methylphenyl]-4,5,6,7-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 59932910 |
| Molecular Formula | C20H24Cl2NO2P |
| Molecular Weight | 412.30 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | 2-[4-chloro-5-[2-chloro-2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-2-methylphenyl]-4,5,6,7-tetrahydroisoindole-1,3-dione |
| SMILES | C=P(C)(C)C(Cl)Cc1cc(N2C(=O)C3=C(CCCC3)C2=O)c(C)cc1Cl |
| InChI | InChI=1S/C20H24Cl2NO2P/c1-12-9-16(21)13(11-18(22)26(2,3)4)10-17(12)23-19(24)14-7-5-6-8-15(14)20(23)25/h9-10,18H,2,5-8,11H2,1,3-4H3 |
| InChIKey | SBLNAAMMPURMQM-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.30 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|