C16H17NO4 — CID 59933606
N-(2,5-dihydroxyphenyl)-2-(2,4-dimethylphenoxy)acetamide (PubChem CID 59933606) has the molecular formula C16H17NO4 and a molecular weight of 287.31 g/mol. Its IUPAC name is N-(2,5-dihydroxyphenyl)-2-(2,4-dimethylphenoxy)acetamide.
| Compound Name | N-(2,5-dihydroxyphenyl)-2-(2,4-dimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 59933606 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | N-(2,5-dihydroxyphenyl)-2-(2,4-dimethylphenoxy)acetamide |
| SMILES | Cc1ccc(OCC(=O)Nc2cc(O)ccc2O)c(C)c1 |
| InChI | InChI=1S/C16H17NO4/c1-10-3-6-15(11(2)7-10)21-9-16(20)17-13-8-12(18)4-5-14(13)19/h3-8,18-19H,9H2,1-2H3,(H,17,20) |
| InChIKey | PKOZWKPHMYBAOT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|