About N,N-dimethylethanesulfonamide;yttrium
N,N-dimethylethanesulfonamide;yttrium (PubChem CID 59933785) has the molecular formula C4H10NO2SY-
and a molecular weight of 225.10 g/mol. Its IUPAC name is N,N-dimethylethanesulfonamide;yttrium.
Molecular Properties
| Compound Name | N,N-dimethylethanesulfonamide;yttrium |
| PubChem CID | 59933785 |
| Molecular Formula | C4H10NO2SY- |
| Molecular Weight | 225.10 g/mol |
| Exact Mass | 224.95 |
| IUPAC Name | N,N-dimethylethanesulfonamide;yttrium |
| SMILES | C[CH-]S(=O)(=O)N(C)C.[Y] |
| InChI | InChI=1S/C4H10NO2S.Y/c1-4-8(6,7)5(2)3;/h4H,1-3H3;/q-1; |
| InChIKey | IIKYHGWPWZOEJN-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.10 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylethanesulfonamide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylethanesulfonamide;yttrium?
The IUPAC name of N,N-dimethylethanesulfonamide;yttrium (CID 59933785) is N,N-dimethylethanesulfonamide;yttrium.
What is the SMILES notation for N,N-dimethylethanesulfonamide;yttrium?
The canonical SMILES for N,N-dimethylethanesulfonamide;yttrium is C[CH-]S(=O)(=O)N(C)C.[Y].
What is the InChIKey of N,N-dimethylethanesulfonamide;yttrium?
The InChIKey is IIKYHGWPWZOEJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10NO2S.Y/c1-4-8(6,7)5(2)3;/h4H,1-3H3;/q-1;.
What are the key properties of N,N-dimethylethanesulfonamide;yttrium?
N,N-dimethylethanesulfonamide;yttrium has a molecular weight of 225.10 g/mol, XLogP of 0.06, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylethanesulfonamide;yttrium is sourced from PubChem (CID 59933785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).