C16H21N — CID 59934239
9-ethyl-4,5-dimethyl-1,2,3,4-tetrahydrocarbazole (PubChem CID 59934239) has the molecular formula C16H21N and a molecular weight of 227.35 g/mol. Its IUPAC name is 9-ethyl-4,5-dimethyl-1,2,3,4-tetrahydrocarbazole.
| Compound Name | 9-ethyl-4,5-dimethyl-1,2,3,4-tetrahydrocarbazole |
|---|---|
| PubChem CID | 59934239 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | 9-ethyl-4,5-dimethyl-1,2,3,4-tetrahydrocarbazole |
| SMILES | CCn1c2c(c3c(C)cccc31)C(C)CCC2 |
| InChI | InChI=1S/C16H21N/c1-4-17-13-9-5-7-11(2)15(13)16-12(3)8-6-10-14(16)17/h5,7,9,12H,4,6,8,10H2,1-3H3 |
| InChIKey | GDQUUAKJDHREBM-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |