C22H21BrN2OS — CID 59934278
(4-bromophenyl)-[4-[4-(dimethylamino)phenyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]methanone (PubChem CID 59934278) has the molecular formula C22H21BrN2OS and a molecular weight of 441.39 g/mol. Its IUPAC name is (4-bromophenyl)-[4-[4-(dimethylamino)phenyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]methanone.
| Compound Name | (4-bromophenyl)-[4-[4-(dimethylamino)phenyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]methanone |
|---|---|
| PubChem CID | 59934278 |
| Molecular Formula | C22H21BrN2OS |
| Molecular Weight | 441.39 g/mol |
| Exact Mass | 440.06 |
| IUPAC Name | (4-bromophenyl)-[4-[4-(dimethylamino)phenyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]methanone |
| SMILES | CN(C)c1ccc(C2c3ccsc3CCN2C(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C22H21BrN2OS/c1-24(2)18-9-5-15(6-10-18)21-19-12-14-27-20(19)11-13-25(21)22(26)16-3-7-17(23)8-4-16/h3-10,12,14,21H,11,13H2,1-2H3 |
| InChIKey | FTVDSTCNPUZVGM-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.39 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|