C18H18F3NO — CID 59934418
(Z)-1-(3,4-dimethylphenyl)-N-[[3-(trifluoromethyl)phenyl]methoxy]ethanimine (PubChem CID 59934418) has the molecular formula C18H18F3NO and a molecular weight of 321.34 g/mol. Its IUPAC name is (Z)-1-(3,4-dimethylphenyl)-N-[[3-(trifluoromethyl)phenyl]methoxy]ethanimine.
| Compound Name | (Z)-1-(3,4-dimethylphenyl)-N-[[3-(trifluoromethyl)phenyl]methoxy]ethanimine |
|---|---|
| PubChem CID | 59934418 |
| Molecular Formula | C18H18F3NO |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | (Z)-1-(3,4-dimethylphenyl)-N-[[3-(trifluoromethyl)phenyl]methoxy]ethanimine |
| SMILES | C/C(=N/OCc1cccc(C(F)(F)F)c1)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C18H18F3NO/c1-12-7-8-16(9-13(12)2)14(3)22-23-11-15-5-4-6-17(10-15)18(19,20)21/h4-10H,11H2,1-3H3/b22-14- |
| InChIKey | MCRKVPLYGVLEOE-HMAPJEAMSA-N |
| XLogP | 5.26 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|