C27H34 — CID 59934579
5-ethyl-1,1,1',1'-tetramethyl-5'-(2-methylprop-2-enyl)-3,3'-spirobi[2H-indene] (PubChem CID 59934579) has the molecular formula C27H34 and a molecular weight of 358.57 g/mol. Its IUPAC name is 5-ethyl-1,1,1',1'-tetramethyl-5'-(2-methylprop-2-enyl)-3,3'-spirobi[2H-indene].
| Compound Name | 5-ethyl-1,1,1',1'-tetramethyl-5'-(2-methylprop-2-enyl)-3,3'-spirobi[2H-indene] |
|---|---|
| PubChem CID | 59934579 |
| Molecular Formula | C27H34 |
| Molecular Weight | 358.57 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | 5-ethyl-1,1,1',1'-tetramethyl-5'-(2-methylprop-2-enyl)-3,3'-spirobi[2H-indene] |
| SMILES | C=C(C)Cc1ccc2c(c1)C1(CC(C)(C)c3ccc(CC)cc31)CC2(C)C |
| InChI | InChI=1S/C27H34/c1-8-19-9-11-21-23(14-19)27(16-25(21,4)5)17-26(6,7)22-12-10-20(13-18(2)3)15-24(22)27/h9-12,14-15H,2,8,13,16-17H2,1,3-7H3 |
| InChIKey | BGDDYBDSBXDITI-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.57 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|