C21H34O2 — CID 59934803
(1R,7aR)-1-[(2R)-1-(4-methoxy-3,4-dimethylcyclopent-2-en-1-yl)propan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one (PubChem CID 59934803) has the molecular formula C21H34O2 and a molecular weight of 318.50 g/mol. Its IUPAC name is (1R,7aR)-1-[(2R)-1-(4-methoxy-3,4-dimethylcyclopent-2-en-1-yl)propan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one.
| Compound Name | (1R,7aR)-1-[(2R)-1-(4-methoxy-3,4-dimethylcyclopent-2-en-1-yl)propan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
|---|---|
| PubChem CID | 59934803 |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | (1R,7aR)-1-[(2R)-1-(4-methoxy-3,4-dimethylcyclopent-2-en-1-yl)propan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
| SMILES | COC1(C)CC(C[C@@H](C)[C@H]2CCC3C(=O)CCC[C@@]32C)C=C1C |
| InChI | InChI=1S/C21H34O2/c1-14(11-16-12-15(2)21(4,13-16)23-5)17-8-9-18-19(22)7-6-10-20(17,18)3/h12,14,16-18H,6-11,13H2,1-5H3/t14-,16?,17-,18?,20-,21?/m1/s1 |
| InChIKey | LLGNQALEZPICAZ-PDRYEXLRSA-N |
| XLogP | 5.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|